cas: 219821-18-8 — see every product listed under this CAS number, including other names
(S)-4-Benzylthiazolidin-2-one, 98% (CAS 219821-18-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A138208-25g |
| cas | 219821-18-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 10225.60 Pln | |
| AmBeed | 250mg | 493.15 Pln | |
| AmBeed | 10g | 5147.80 Pln | |
| AmBeed | 5g | 3116.68 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4S)-4-benzyl-1,3-thiazolidin-2-one (CAS 219821-18-8) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: (4S)-4-benzyl-1,3-thiazolidin-2-one. InChIKey: HOTCRDXCVRFUOW-VIFPVBQESA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | (4S)-4-benzyl-1,3-thiazolidin-2-one |
| InChIKey | HOTCRDXCVRFUOW-VIFPVBQESA-N |
| SMILES | C1[C@@H](NC(=O)S1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)