CAS 219821-18-8 appears in our catalog under these names: (S)-4-Benzyl-1,3-thiazolidine-2-one, 98%, (S)-4-Benzylthiazolidin-2-one, 98%, (S)–4–benzyl–1,3–thiazolidin–2–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
(4S)-4-benzyl-1,3-thiazolidin-2-one (CAS 219821-18-8) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: (4S)-4-benzyl-1,3-thiazolidin-2-one. InChIKey: HOTCRDXCVRFUOW-VIFPVBQESA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | (4S)-4-benzyl-1,3-thiazolidin-2-one |
| InChIKey | HOTCRDXCVRFUOW-VIFPVBQESA-N |
| SMILES | C1[C@@H](NC(=O)S1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)