CAS 737000-99-6 is the registry number for (S)-(+)-1-(3-Methoxyphenyl)ethyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(1S)-1-isothiocyanatoethyl]-3-methoxybenzene (CAS 737000-99-6) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: 1-[(1S)-1-isothiocyanatoethyl]-3-methoxybenzene. InChIKey: VLULNKVRCHBYJM-QMMMGPOBSA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 1-[(1S)-1-isothiocyanatoethyl]-3-methoxybenzene |
| InChIKey | VLULNKVRCHBYJM-QMMMGPOBSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)OC)N=C=S |
Computed by PubChem (NCBI)