CAS 63816-00-2 is the registry number for 6-Methoxy-2,5-dimethylbenzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxy-2,5-dimethyl-1,3-benzothiazole (CAS 63816-00-2) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: 6-methoxy-2,5-dimethyl-1,3-benzothiazole. InChIKey: AVBHDKMHDNTVLR-UHFFFAOYSA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 6-methoxy-2,5-dimethyl-1,3-benzothiazole |
| InChIKey | AVBHDKMHDNTVLR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1OC)SC(=N2)C |
Computed by PubChem (NCBI)