CAS 854067-08-6 is the registry number for 2,2-Dimethyl-2,3-dihydro-4H-benzo[e][1,3]thiazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-3H-1,3-benzothiazin-4-one (CAS 854067-08-6) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: 2,2-dimethyl-3H-1,3-benzothiazin-4-one. InChIKey: AUWYRPLRWATMEQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 2,2-dimethyl-3H-1,3-benzothiazin-4-one |
| InChIKey | AUWYRPLRWATMEQ-UHFFFAOYSA-N |
| SMILES | CC1(NC(=O)C2=CC=CC=C2S1)C |
Computed by PubChem (NCBI)