Products 749261-39-0
CAS 749261-39-0 appears in our catalog under these names: (R)-(-)-1-(3-Methoxyphenyl)ethyl isothiocyanate, 95%, (R)–(–)–1–(3–Methoxyphenyl)ethyl isothiocyanate, (R)-(-)-1-(3-Methoxyphenyl)ethyl isothiocyanate, 97%, ≥97%, ≥97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 50mg.
1-[(1R)-1-isothiocyanatoethyl]-3-methoxybenzene (CAS 749261-39-0) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: 1-[(1R)-1-isothiocyanatoethyl]-3-methoxybenzene. InChIKey: VLULNKVRCHBYJM-MRVPVSSYSA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 1-[(1R)-1-isothiocyanatoethyl]-3-methoxybenzene |
| InChIKey | VLULNKVRCHBYJM-MRVPVSSYSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)OC)N=C=S |
Computed by PubChem (NCBI)