cas: 225517-81-7 — see every product listed under this CAS number, including other names
(S)-4-N-Cbz-Piperazine-2-carboxylic acid methylester, 97% (CAS 225517-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034507-100MG |
| cas | 225517-81-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1559.89 Pln | |
| Fluorochem | 10g | 2700.11 Pln | |
| Fluorochem | 25g | 5782.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate (CAS 225517-81-7) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate. InChIKey: FYKXWBBQYZXPFB-LBPRGKRZSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate |
| InChIKey | FYKXWBBQYZXPFB-LBPRGKRZSA-N |
| SMILES | COC(=O)[C@@H]1CN(CCN1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)