Products 405175-79-3

CAS 405175-79-3 is the registry number for (R)-4-N-Cbz-piperazine-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate (CAS 405175-79-3) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate. InChIKey: FYKXWBBQYZXPFB-GFCCVEGCSA-N.

Identity
Molecular formulaC14H18N2O4
Molecular weight278.30 g/mol
IUPAC name1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate
InChIKeyFYKXWBBQYZXPFB-GFCCVEGCSA-N
SMILESCOC(=O)[C@H]1CN(CCN1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)