cas: 1260609-97-9 — see every product listed under this CAS number, including other names
(S)-6-Fluorochroman-4-amine hydrochloride 95% (CAS 1260609-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A188281-100mg |
| cas | 1260609-97-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 2267.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A188281 |
(4S)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1260609-97-9) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: (4S)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: VHMBQKMHABXVJN-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | (4S)-6-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | VHMBQKMHABXVJN-QRPNPIFTSA-N |
| SMILES | C1COC2=C([C@H]1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)