cas: 105183-60-6 — see every product listed under this CAS number, including other names
(S)-BENZYL 2-((TERT-BUTOXYCARBONYL)AMINO)-4-HYDROXYBUTANOATE, 98% (CAS 105183-60-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472786-100MG |
| cas | 105183-60-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 2632.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 105183-60-6) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: benzyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: YQTGYJUMDNISEP-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | benzyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | YQTGYJUMDNISEP-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)