cas: 65615-89-6 — see every product listed under this CAS number, including other names
(S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(4-nitrophenyl)propanoate, 98% (CAS 65615-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A799029-100mg |
| cas | 65615-89-6 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 102.55 Pln | |
| AmBeed | 250mg | 109.06 Pln | |
| AmBeed | 1g | 219.73 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 935.11 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoate (CAS 65615-89-6) is a chemical compound with the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoate. InChIKey: OIPSJKHEYTWZBQ-LBPRGKRZSA-N.
| Molecular formula | C15H20N2O6 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoate |
| InChIKey | OIPSJKHEYTWZBQ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)