CAS 19542-34-8 appears in our catalog under these names: Methyl ((benzyloxy)carbonyl)-L-alanyl-L-serinate, 98%, Z–Ala–Ser–OMe, Z-Ala-Ser-OMe. Offered by: Chemat Brand, GLPBio, Biosynth. Available pack sizes: on request, 25g, 5g, 10g, 50g, 100g.
Methyl (2S)-3-hydroxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate (CAS 19542-34-8) is a chemical compound with the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. IUPAC name: methyl (2S)-3-hydroxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate. InChIKey: IDVXGMLTOPUJTE-JQWIXIFHSA-N.
| Molecular formula | C15H20N2O6 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | methyl (2S)-3-hydroxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
| InChIKey | IDVXGMLTOPUJTE-JQWIXIFHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CO)C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)