CAS 219297-12-8 appears in our catalog under these names: Boc-(r)-3-amino-4-(4-nitrophenyl)butanoic acid, 97%, (R)-3-((tert-Butoxycarbonyl)amino)-4-(4-nitrophenyl)butanoic acid, 96%, 96%, (R)-3-((tert-Butoxycarbonyl)amino)-4-(4-nitrophenyl)butanoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-nitrophenyl)butanoic acid (CAS 219297-12-8) is a chemical compound with the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-nitrophenyl)butanoic acid. InChIKey: HTDDLFNQWIQXQX-LLVKDONJSA-N.
| Molecular formula | C15H20N2O6 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-nitrophenyl)butanoic acid |
| InChIKey | HTDDLFNQWIQXQX-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)