CAS 2407907-30-4 is the registry number for Methyl ((benzyloxy)carbonyl)-D-seryl-L-alaninate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-[[(2R)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate (CAS 2407907-30-4) is a chemical compound with the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. IUPAC name: methyl (2S)-2-[[(2R)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate. InChIKey: QWGCABODXPAQFR-CMPLNLGQSA-N.
| Molecular formula | C15H20N2O6 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | methyl (2S)-2-[[(2R)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
| InChIKey | QWGCABODXPAQFR-CMPLNLGQSA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)[C@@H](CO)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)