Products 861453-12-5
CAS 861453-12-5 appears in our catalog under these names: Gefitinib Impurity 45, Gefitinib Impurity 35. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-methoxy-5-(3-morpholin-4-ylpropoxy)-2-nitrobenzaldehyde (CAS 861453-12-5) is a chemical compound with the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. IUPAC name: 4-methoxy-5-(3-morpholin-4-ylpropoxy)-2-nitrobenzaldehyde. InChIKey: JHGZMCANMMWSQB-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O6 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | 4-methoxy-5-(3-morpholin-4-ylpropoxy)-2-nitrobenzaldehyde |
| InChIKey | JHGZMCANMMWSQB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])C=O)OCCCN2CCOCC2 |
Computed by PubChem (NCBI)