Products 67708-97-8
CAS 67708-97-8 is the registry number for Boc-abu-onp, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 67708-97-8) is a chemical compound with the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: RCWVQAPDWRVKHZ-LBPRGKRZSA-N.
| Molecular formula | C15H20N2O6 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | RCWVQAPDWRVKHZ-LBPRGKRZSA-N |
| SMILES | CC[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)