cas: 139040-51-0 — see every product listed under this CAS number, including other names
(S)-Methyl 3-([1,1'-biphenyl]-4-yl)-2-aminopropanoate, 97%, 97% (CAS 139040-51-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K12I-100mg |
| cas | 139040-51-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 2003.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(4-phenylphenyl)propanoate (CAS 139040-51-0) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-phenylphenyl)propanoate. InChIKey: ZABGKWGFGXZMDE-HNNXBMFYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-phenylphenyl)propanoate |
| InChIKey | ZABGKWGFGXZMDE-HNNXBMFYSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)