Products 1272946-08-3
CAS 1272946-08-3 appears in our catalog under these names: 4-[(4-Isopropylphenyl)amino]benzoic acid, 95%, 4-((4-Isopropylphenyl)amino)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(4-propan-2-ylanilino)benzoic acid (CAS 1272946-08-3) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: 4-(4-propan-2-ylanilino)benzoic acid. InChIKey: LKARJMNRJSXCGK-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 4-(4-propan-2-ylanilino)benzoic acid |
| InChIKey | LKARJMNRJSXCGK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)