CAS 962-39-0 appears in our catalog under these names: Benzyl 3-phenyl-l-alaninate, 95%, (S)-Benzyl 2-amino-3-phenylpropanoate, 95%, Benzyl 3–phenyl–L–alaninate, L-Phenylalanine benzyl ester. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100g, 25g, 5g, 10g, 15g.
Benzyl (2S)-2-amino-3-phenylpropanoate (CAS 962-39-0) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: benzyl (2S)-2-amino-3-phenylpropanoate. InChIKey: FPRSPUHXEPWUBZ-HNNXBMFYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-phenylpropanoate |
| InChIKey | FPRSPUHXEPWUBZ-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)