CAS 196395-12-7 appears in our catalog under these names: L-Phenylalanine, beta-phenyl-, methyl ester, 98%, (S)-Methyl 2-amino-3,3-diphenylpropanoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-amino-3,3-diphenylpropanoate (CAS 196395-12-7) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: methyl (2S)-2-amino-3,3-diphenylpropanoate. InChIKey: JJIQQSXXWLDXNO-HNNXBMFYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl (2S)-2-amino-3,3-diphenylpropanoate |
| InChIKey | JJIQQSXXWLDXNO-HNNXBMFYSA-N |
| SMILES | COC(=O)[C@H](C(C1=CC=CC=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)