Products 351001-24-6

CAS 351001-24-6 is the registry number for 2-Ethyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-ethyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid (CAS 351001-24-6) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: 2-ethyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid. InChIKey: UMZDTQJCQBRJLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO2
Molecular weight255.31 g/mol
IUPAC name2-ethyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid
InChIKeyUMZDTQJCQBRJLQ-UHFFFAOYSA-N
SMILESCCC1CCC2=NC3=CC=CC=C3C(=C2C1)C(=O)O

Computed by PubChem (NCBI)