cas: 4465-44-5 — see every product listed under this CAS number, including other names
(S)-Methyl 3-hydroxy-2-(tritylamino)propanoate, 95%, 95% (CAS 4465-44-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SFV-250mg |
| cas | 4465-44-5 |
| size | 250mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 50g | 266.00 Pln | |
| Chemat | 100g | 434.00 Pln | |
| Chemat | 500g | 1555.20 Pln | |
| Chemat | 1kg | 2704.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-3-hydroxy-2-(tritylamino)propanoate (CAS 4465-44-5) is a chemical compound with the molecular formula C23H23NO3 and a molecular weight of 361.4 g/mol. IUPAC name: methyl (2S)-3-hydroxy-2-(tritylamino)propanoate. InChIKey: LXAWQKKSNNYYEK-NRFANRHFSA-N.
| Molecular formula | C23H23NO3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | methyl (2S)-3-hydroxy-2-(tritylamino)propanoate |
| InChIKey | LXAWQKKSNNYYEK-NRFANRHFSA-N |
| SMILES | COC(=O)[C@H](CO)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)