cas: 4465-44-5 — see every product listed under this CAS number, including other names
Trt-Ser-OMe, 95% (CAS 4465-44-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A412821-250mg |
| cas | 4465-44-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 676.31 Pln | |
| Ambeed | 500g | 2856.81 Pln | |
| Ambeed | 1kg | 4820.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (2S)-3-hydroxy-2-(tritylamino)propanoate (CAS 4465-44-5) is a chemical compound with the molecular formula C23H23NO3 and a molecular weight of 361.4 g/mol. IUPAC name: methyl (2S)-3-hydroxy-2-(tritylamino)propanoate. InChIKey: LXAWQKKSNNYYEK-NRFANRHFSA-N.
| Molecular formula | C23H23NO3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | methyl (2S)-3-hydroxy-2-(tritylamino)propanoate |
| InChIKey | LXAWQKKSNNYYEK-NRFANRHFSA-N |
| SMILES | COC(=O)[C@H](CO)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)