cas: 119904-90-4 — see every product listed under this CAS number, including other names
(S)-Quinuclidin-3-amine 2HCl 97% (CAS 119904-90-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A173742-250mg |
| cas | 119904-90-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 370.38 Pln | |
| Ambeed | 25g | 793.12 Pln | |
| Ambeed | 100g | 2940.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A173742 |
(3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CAS 119904-90-4) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride. InChIKey: STZHBULOYDCZET-XCUBXKJBSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| InChIKey | STZHBULOYDCZET-XCUBXKJBSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)N.Cl.Cl |
Computed by PubChem (NCBI)