cas: 153287-86-6 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate, 95% (CAS 153287-86-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447091-250MG |
| cas | 153287-86-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1716.08 Pln | |
| Fluorochem | 5g | 5230.47 Pln | |
| Fluorochem | 10g | 7807.69 Pln | |
| Fluorochem | 25g | 13336.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 153287-86-6) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: tert-butyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: VYLKHZZDXASXLR-VIFPVBQESA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | tert-butyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | VYLKHZZDXASXLR-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CO)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)