cas: 1663-61-2 — see every product listed under this CAS number, including other names
(Triethoxymethyl)benzene, 95%, 95% (CAS 1663-61-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WMF-1g |
| cas | 1663-61-2 |
| size | 1g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 69.20 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 500g | 556.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Triethoxymethylbenzene (CAS 1663-61-2) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: triethoxymethylbenzene. InChIKey: BQFPCTXLBRVFJL-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | triethoxymethylbenzene |
| InChIKey | BQFPCTXLBRVFJL-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CC=CC=C1)(OCC)OCC |
Computed by PubChem (NCBI)