cas: 1663-61-2 — see every product listed under this CAS number, including other names
Triethyl Orthobenzoate, >97.0%(GC) (CAS 1663-61-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3070-5G |
| cas | 1663-61-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 147.85 Pln | |
| TCI | 25g | 452.72 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
Triethoxymethylbenzene (CAS 1663-61-2) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: triethoxymethylbenzene. InChIKey: BQFPCTXLBRVFJL-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | triethoxymethylbenzene |
| InChIKey | BQFPCTXLBRVFJL-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CC=CC=C1)(OCC)OCC |
Computed by PubChem (NCBI)