cas: 1663-61-2 — see every product listed under this CAS number, including other names
(Triethoxymethyl)benzene, 95% (CAS 1663-61-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238836-25G |
| cas | 1663-61-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 200.99 Pln | |
| Fluorochem | 500g | 784.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Triethoxymethylbenzene (CAS 1663-61-2) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: triethoxymethylbenzene. InChIKey: BQFPCTXLBRVFJL-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | triethoxymethylbenzene |
| InChIKey | BQFPCTXLBRVFJL-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CC=CC=C1)(OCC)OCC |
Computed by PubChem (NCBI)