cas: 1406786-33-1 — see every product listed under this CAS number, including other names
[(5-Bromopyridin-2-yl)methyl](tert-butyl)amine (CAS 1406786-33-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTGV-1g |
| cas | 1406786-33-1 |
| size | 1g |
| availability | 6.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 6074.00 Pln |
| delivery time | 3 weeks |
|---|
N-[(5-bromo-2-pyridinyl)methyl]-2-methylpropan-2-amine (CAS 1406786-33-1) is a chemical compound with the molecular formula C10H15BrN2 and a molecular weight of 243.14 g/mol. IUPAC name: N-[(5-bromo-2-pyridinyl)methyl]-2-methylpropan-2-amine. InChIKey: LVPVGDVGGWEWMY-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2 |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | N-[(5-bromo-2-pyridinyl)methyl]-2-methylpropan-2-amine |
| InChIKey | LVPVGDVGGWEWMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)