CAS 1163707-72-9 appears in our catalog under these names: 5-Bromo-1-N-tert-butylbenzene-1,2-diamine, 98%, 5-Bromo-N1-(tert-butyl)benzene-1,2-diamine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-bromo-2-N-tert-butylbenzene-1,2-diamine (CAS 1163707-72-9) is a chemical compound with the molecular formula C10H15BrN2 and a molecular weight of 243.14 g/mol. IUPAC name: 4-bromo-2-N-tert-butylbenzene-1,2-diamine. InChIKey: XJZIXRNBUGMBOI-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2 |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 4-bromo-2-N-tert-butylbenzene-1,2-diamine |
| InChIKey | XJZIXRNBUGMBOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=C(C=CC(=C1)Br)N |
Computed by PubChem (NCBI)