Products 2177257-93-9
CAS 2177257-93-9 is the registry number for 4-Bromo-n-(tert-butyl)-6-methylpyridin-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-bromo-N-tert-butyl-6-methylpyridin-2-amine (CAS 2177257-93-9) is a chemical compound with the molecular formula C10H15BrN2 and a molecular weight of 243.14 g/mol. IUPAC name: 4-bromo-N-tert-butyl-6-methylpyridin-2-amine. InChIKey: QPLGPBSJLXREIF-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2 |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 4-bromo-N-tert-butyl-6-methylpyridin-2-amine |
| InChIKey | QPLGPBSJLXREIF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)NC(C)(C)C)Br |
Computed by PubChem (NCBI)