CAS 951917-59-2 is the registry number for [2-Amino-1-(3-bromophenyl)ethyl]dimethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3-bromophenyl)-N,N-dimethylethane-1,2-diamine (CAS 951917-59-2) is a chemical compound with the molecular formula C10H15BrN2 and a molecular weight of 243.14 g/mol. IUPAC name: 1-(3-bromophenyl)-N,N-dimethylethane-1,2-diamine. InChIKey: OYMFXONHTUORJI-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2 |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 1-(3-bromophenyl)-N,N-dimethylethane-1,2-diamine |
| InChIKey | OYMFXONHTUORJI-UHFFFAOYSA-N |
| SMILES | CN(C)C(CN)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)