CAS 105294-26-6 appears in our catalog under these names: 2-Bromo-1-N,1-N-diethylbenzene-1,4-diamine, 95%, 2-Bromo-N1,N1-diethylbenzene-1,4-diamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-1-N,1-N-diethylbenzene-1,4-diamine (CAS 105294-26-6) is a chemical compound with the molecular formula C10H15BrN2 and a molecular weight of 243.14 g/mol. IUPAC name: 2-bromo-1-N,1-N-diethylbenzene-1,4-diamine. InChIKey: UZFLGRXTQZZGFS-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2 |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 2-bromo-1-N,1-N-diethylbenzene-1,4-diamine |
| InChIKey | UZFLGRXTQZZGFS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=C1)N)Br |
Computed by PubChem (NCBI)