CAS 951917-39-8 appears in our catalog under these names: [2-Amino-1-(4-bromophenyl)ethyl]dimethylamine, 98%, 1-(4-Bromophenyl)-N1,N1-dimethylethane-1,2-diamine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-(4-bromophenyl)-N,N-dimethylethane-1,2-diamine (CAS 951917-39-8) is a chemical compound with the molecular formula C10H15BrN2 and a molecular weight of 243.14 g/mol. IUPAC name: 1-(4-bromophenyl)-N,N-dimethylethane-1,2-diamine. InChIKey: RRKBCANPLPFWSQ-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2 |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)-N,N-dimethylethane-1,2-diamine |
| InChIKey | RRKBCANPLPFWSQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(CN)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)