[1,1':4',1''-Terphenyl]-3,3'',5,5''-tetracarbaldehyde, 97%
cas: 2380275-62-5 — see every product listed under this CAS number, including other names
[1,1':4',1''-Terphenyl]-3,3'',5,5''-tetracarbaldehyde, 97% (CAS 2380275-62-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 15g, 25g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1489883-250mg |
| cas | 2380275-62-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 615.13 Pln | |
| Ambeed | 5g | 1994.62 Pln | |
| BLDpharm | 100mg | 158.86 Pln | |
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 658.68 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1720.40 Pln | |
| Chemat | 10g | 3309.20 Pln | |
| Chemat | 15g | 4782.80 Pln | |
| Chemat | 25g | 7178.00 Pln | |
| Fluorochem | 5g | 2054.50 Pln | |
| Fluorochem | 100mg | 148.92 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 633.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-[4-(3,5-diformylphenyl)phenyl]benzene-1,3-dicarbaldehyde (CAS 2380275-62-5) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 5-[4-(3,5-diformylphenyl)phenyl]benzene-1,3-dicarbaldehyde. InChIKey: NGXJSBPRIWFZJI-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 5-[4-(3,5-diformylphenyl)phenyl]benzene-1,3-dicarbaldehyde |
| InChIKey | NGXJSBPRIWFZJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C=O)C=O)C3=CC(=CC(=C3)C=O)C=O |
Computed by PubChem (NCBI)