Products 2380275-62-5
CAS 2380275-62-5 appears in our catalog under these names: (1,1'：4',1''–Terphenyl)–3,3'',5,5''–tetracarbaldehyde, [1,1':4',1''-Terphenyl]-3,3'',5,5''-tetracarbaldehyde 97%, [1,1':4',1''-Terphenyl]-3,3'',5,5''-tetracarbaldehyde, 97%, 97%, [1,1':4',1''-Terphenyl]-3,3'',5,5''-tetracarbaldehyde, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 15g, 25g.
5-[4-(3,5-diformylphenyl)phenyl]benzene-1,3-dicarbaldehyde (CAS 2380275-62-5) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 5-[4-(3,5-diformylphenyl)phenyl]benzene-1,3-dicarbaldehyde. InChIKey: NGXJSBPRIWFZJI-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 5-[4-(3,5-diformylphenyl)phenyl]benzene-1,3-dicarbaldehyde |
| InChIKey | NGXJSBPRIWFZJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C=O)C=O)C3=CC(=CC(=C3)C=O)C=O |
Computed by PubChem (NCBI)