CAS 123524-53-8 appears in our catalog under these names: (1,1'–Binaphthalene)–4,4'–dicarboxylic acid, [1,1'-Binaphthalene]-4,4'-dicarboxylic acid 98%, [1,1′-Binaphthalene]-4,4′-dicarboxylic acid, 98%, 98%, [1,1'-Binaphthalene]-4,4'-dicarboxylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(4-carboxynaphthalen-1-yl)naphthalene-1-carboxylic acid (CAS 123524-53-8) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 4-(4-carboxynaphthalen-1-yl)naphthalene-1-carboxylic acid. InChIKey: LPJFECYYLUQKSO-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 4-(4-carboxynaphthalen-1-yl)naphthalene-1-carboxylic acid |
| InChIKey | LPJFECYYLUQKSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C3=CC=C(C4=CC=CC=C43)C(=O)O |
Computed by PubChem (NCBI)