CAS 96065-65-5 is the registry number for [1,1'-Binaphthalene]-5,5'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5-carboxynaphthalen-1-yl)naphthalene-1-carboxylic acid (CAS 96065-65-5) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 5-(5-carboxynaphthalen-1-yl)naphthalene-1-carboxylic acid. InChIKey: NYCYFKWWWOHTIY-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 5-(5-carboxynaphthalen-1-yl)naphthalene-1-carboxylic acid |
| InChIKey | NYCYFKWWWOHTIY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2C(=O)O)C(=C1)C3=CC=CC4=C3C=CC=C4C(=O)O |
Computed by PubChem (NCBI)