CAS 1293999-95-7 is the registry number for (1S)-2,2'-Dihydroxy-[1,1'-binaphthalene]-6,6'-dicarbaldehyde 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-(6-formyl-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalene-2-carbaldehyde (CAS 1293999-95-7) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 5-(6-formyl-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalene-2-carbaldehyde. InChIKey: BFXFHYYEOAFBJC-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 5-(6-formyl-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalene-2-carbaldehyde |
| InChIKey | BFXFHYYEOAFBJC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C3=C(C=CC4=C3C=CC(=C4)C=O)O)O)C=C1C=O |
Computed by PubChem (NCBI)