Products 1985610-10-3
CAS 1985610-10-3 appears in our catalog under these names: (1,1'：4',1''–Terphenyl)–2',4,4'',5'–tetracarbaldehyde, [1,1':4',1''-Terphenyl]-2',4,4'',5'-tetracarbaldehyde 98%, [1，1':4'，1''-Terphenyl]-2'，4，4''，5'-tetracarbaldehyde, 98%, 98%, [1,1':4',1''-Terphenyl]-2',4,4'',5'-tetracarbaldehyde, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
2,5-bis(4-formylphenyl)terephthalaldehyde (CAS 1985610-10-3) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 2,5-bis(4-formylphenyl)terephthalaldehyde. InChIKey: RWBVIFOAWUGLCE-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 2,5-bis(4-formylphenyl)terephthalaldehyde |
| InChIKey | RWBVIFOAWUGLCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=C(C=C2C=O)C3=CC=C(C=C3)C=O)C=O |
Computed by PubChem (NCBI)