[1,1':4',1''-Terphenyl]-4-ylboronic acid, 97%
cas: 877993-09-4 — see every product listed under this CAS number, including other names
[1,1':4',1''-Terphenyl]-4-ylboronic acid, 97% (CAS 877993-09-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD435490-250mg |
| cas | 877993-09-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 164.41 Pln | |
| BLDpharm | 5g | 403.22 Pln | |
| BLDpharm | 25g | 1208.49 Pln | |
| BLDpharm | 100g | 3835.34 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 328.40 Pln | |
| Chemat | 25g | 616.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[4-(4-phenylphenyl)phenyl]boronic acid (CAS 877993-09-4) is a chemical compound with the molecular formula C18H15BO2 and a molecular weight of 274.1 g/mol. IUPAC name: [4-(4-phenylphenyl)phenyl]boronic acid. InChIKey: UAYHYNNEZRKUSH-UHFFFAOYSA-N.
| Molecular formula | C18H15BO2 |
|---|---|
| Molecular weight | 274.1 g/mol |
| IUPAC name | [4-(4-phenylphenyl)phenyl]boronic acid |
| InChIKey | UAYHYNNEZRKUSH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)
