CAS 932033-58-4 appears in our catalog under these names: Adapalene EP Impurity A, 2,2'-Binaphthalene-6,6'-dicarboxylic Acid, >95% (HPLC), 2,2'-Binaphthalene-6,6'-dicarboxylic Acid, (2,2'–Binaphthalene)–6,6'–dicarboxylic acid, [2,2′-Binaphthalene]-6,6′-dicarboxylic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 25mg, 50mg, 5mg, 100mg, 1g, 250mg, 5g.
6-(6-carboxynaphthalen-2-yl)naphthalene-2-carboxylic acid (CAS 932033-58-4) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 6-(6-carboxynaphthalen-2-yl)naphthalene-2-carboxylic acid. InChIKey: HWEIPTRZTZNYNO-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 6-(6-carboxynaphthalen-2-yl)naphthalene-2-carboxylic acid |
| InChIKey | HWEIPTRZTZNYNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C=C1C3=CC4=C(C=C3)C=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)