Products 194873-98-8
CAS 194873-98-8 appears in our catalog under these names: 4‚Ä≤-Methoxy-3-(trifluoromethyl)-1,1‚Ä≤-biphenyl, 95-<97%, 4‚Ä≤-Methoxy-3-(trifluoromethyl)-1,1‚Ä≤-biphenyl, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-methoxy-4-[3-(trifluoromethyl)phenyl]benzene (CAS 194873-98-8) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: 1-methoxy-4-[3-(trifluoromethyl)phenyl]benzene. InChIKey: PLCMWCLPLSJTEH-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | 1-methoxy-4-[3-(trifluoromethyl)phenyl]benzene |
| InChIKey | PLCMWCLPLSJTEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)