CAS 379-18-0 appears in our catalog under these names: 2,2,2-Trifluoro-1,1-diphenylethanol 95%, a-(Trifluoromethyl)benzhydrol, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2,2,2-trifluoro-1,1-diphenylethanol (CAS 379-18-0) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: 2,2,2-trifluoro-1,1-diphenylethanol. InChIKey: MJZYEOYNWIIQIV-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | 2,2,2-trifluoro-1,1-diphenylethanol |
| InChIKey | MJZYEOYNWIIQIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(F)(F)F)O |
Computed by PubChem (NCBI)