cas: 1394119-83-5 — see every product listed under this CAS number, including other names
{3-[(tert-butyldimethylsilyl)oxy]cyclobutyl}methanol 95% (CAS 1394119-83-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215380-100mg |
| cas | 1394119-83-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 3657.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A215380 |
[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol (CAS 1394119-83-5) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol. InChIKey: QNUGWZOQASOOEE-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol |
| InChIKey | QNUGWZOQASOOEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)CO |
Computed by PubChem (NCBI)