cas: 836627-56-6 — see every product listed under this CAS number, including other names
β-Bromo-N,N,4-trimethyl-γ-oxobenzenebutanamide, 98%, 98% (CAS 836627-56-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E6EP-25mg |
| cas | 836627-56-6 |
| size | 25mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 611.60 Pln | |
| Chemat | 100mg | 1029.20 Pln | |
| Chemat | 250mg | 1994.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-N,N-dimethyl-4-(4-methylphenyl)-4-oxobutanamide (CAS 836627-56-6) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: 3-bromo-N,N-dimethyl-4-(4-methylphenyl)-4-oxobutanamide. InChIKey: BROZCDKHLQPLCX-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyl-4-(4-methylphenyl)-4-oxobutanamide |
| InChIKey | BROZCDKHLQPLCX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(CC(=O)N(C)C)Br |
Computed by PubChem (NCBI)