(3,4-Difluorophenyl)phenylmethanone, 98%, 98% (CAS 85118-07-6) manufactured by Chemat in a 1g pack.
| brand | Chemat |
|---|---|
| catalog number | Ch114IH1-1g |
| cas | 85118-07-6 |
| size | 1g |
| availability | 200g |
Ask us about this product — we're happy to help.
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,4-difluorophenyl)-phenylmethanone (CAS 85118-07-6) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (3,4-difluorophenyl)-phenylmethanone. InChIKey: ZJTYHSBOZAQQGF-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (3,4-difluorophenyl)-phenylmethanone |
| InChIKey | ZJTYHSBOZAQQGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)