CAS 85118-07-6 appears in our catalog under these names: 3,4–Difluorobenzophenone, 3,4-Difluorobenzophenone, >98.0%(GC), (3,4-Difluorophenyl)(phenyl)methanone 98%, (3,4-Difluorophenyl)phenylmethanone, 98%, 98%, 3,4-Difluorobenzophenone, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1000g, 1g, 10g, 50g.
(3,4-difluorophenyl)-phenylmethanone (CAS 85118-07-6) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (3,4-difluorophenyl)-phenylmethanone. InChIKey: ZJTYHSBOZAQQGF-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (3,4-difluorophenyl)-phenylmethanone |
| InChIKey | ZJTYHSBOZAQQGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)