cas: 752234-64-3 — see every product listed under this CAS number, including other names
1'-Boc-1,2-dihydro-5-Methoxy-2-oxo-spiro[3H-indole-3,4'-piperidine], 98%, 98% (CAS 752234-64-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119QUC-25mg |
| cas | 752234-64-3 |
| size | 25mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 582.80 Pln | |
| Chemat | 50mg | 688.40 Pln | |
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 966.80 Pln | |
| Chemat | 1g | 2315.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 752234-64-3) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: tert-butyl 5-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: ICAYJBMICZNBCC-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | tert-butyl 5-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | ICAYJBMICZNBCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=CC(=C3)OC)NC2=O |
Computed by PubChem (NCBI)