cas: 752234-64-3 — see every product listed under this CAS number, including other names
1'-Boc-1,2-dihydro-5-methoxy-2-oxo-spiro[3H-indole-3,4'-piperidine], 98% (CAS 752234-64-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076181-25MG |
| cas | 752234-64-3 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 976.76 Pln | |
| Fluorochem | 50mg | 1289.15 Pln | |
| Fluorochem | 100mg | 1887.89 Pln | |
| Fluorochem | 250mg | 2809.45 Pln | |
| Fluorochem | 1g | 6901.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 5-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 752234-64-3) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: tert-butyl 5-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: ICAYJBMICZNBCC-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | tert-butyl 5-methoxy-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | ICAYJBMICZNBCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=CC(=C3)OC)NC2=O |
Computed by PubChem (NCBI)